C14H10Cl2FNO4S — CID 95036267
methyl 3-[(2,5-dichlorophenyl)sulfamoyl]-4-fluorobenzoate (PubChem CID 95036267) has the molecular formula C14H10Cl2FNO4S and a molecular weight of 378.21 g/mol. Its IUPAC name is methyl 3-[(2,5-dichlorophenyl)sulfamoyl]-4-fluorobenzoate.
| Compound Name | methyl 3-[(2,5-dichlorophenyl)sulfamoyl]-4-fluorobenzoate |
|---|---|
| PubChem CID | 95036267 |
| Molecular Formula | C14H10Cl2FNO4S |
| Molecular Weight | 378.21 g/mol |
| Exact Mass | 376.97 |
| IUPAC Name | methyl 3-[(2,5-dichlorophenyl)sulfamoyl]-4-fluorobenzoate |
| SMILES | COC(=O)c1ccc(F)c(S(=O)(=O)Nc2cc(Cl)ccc2Cl)c1 |
| InChI | InChI=1S/C14H10Cl2FNO4S/c1-22-14(19)8-2-5-11(17)13(6-8)23(20,21)18-12-7-9(15)3-4-10(12)16/h2-7,18H,1H3 |
| InChIKey | NATPRCYSILACLG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.21 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |