C20H25NO4 — CID 7852289
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 7852289) has the molecular formula C20H25NO4 and a molecular weight of 343.42 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 7852289 |
| Molecular Formula | C20H25NO4 |
| Molecular Weight | 343.42 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccco1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C20H25NO4/c1-13(25-18(22)5-4-17-3-2-6-24-17)19(23)21-20-10-14-7-15(11-20)9-16(8-14)12-20/h2-6,13-16H,7-12H2,1H3,(H,21,23)/b5-4+/t13-,14?,15?,16?,20?/m0/s1 |
| InChIKey | CIYUUWFWSJWVDL-IOSXMZNISA-N |
| XLogP | 3.31 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.42 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|