C17H14F3NO4 — CID 2506483
[(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate (PubChem CID 2506483) has the molecular formula C17H14F3NO4 and a molecular weight of 353.30 g/mol. Its IUPAC name is [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate.
| Compound Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 2506483 |
| Molecular Formula | C17H14F3NO4 |
| Molecular Weight | 353.30 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | [(2S)-1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-(furan-2-yl)prop-2-enoate |
| SMILES | C[C@H](OC(=O)/C=C/c1ccco1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO4/c1-11(25-15(22)9-8-14-3-2-10-24-14)16(23)21-13-6-4-12(5-7-13)17(18,19)20/h2-11H,1H3,(H,21,23)/b9-8+/t11-/m0/s1 |
| InChIKey | OPDYTQHZWDPBFO-FBOQAHMBSA-N |
| XLogP | 3.88 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.30 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|