C22H17F3N2O3 — CID 42973298
[1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 42973298) has the molecular formula C22H17F3N2O3 and a molecular weight of 414.38 g/mol. Its IUPAC name is [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 42973298 |
| Molecular Formula | C22H17F3N2O3 |
| Molecular Weight | 414.38 g/mol |
| Exact Mass | 414.12 |
| IUPAC Name | [1-oxo-1-[4-(trifluoromethyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CC(OC(=O)/C=C/c1ccc2ccccc2n1)C(=O)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H17F3N2O3/c1-14(21(29)27-18-10-7-16(8-11-18)22(23,24)25)30-20(28)13-12-17-9-6-15-4-2-3-5-19(15)26-17/h2-14H,1H3,(H,27,29)/b13-12+ |
| InChIKey | MMZPEHFAHGQYLY-OUKQBFOZSA-N |
| XLogP | 4.84 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.38 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|