C24H25N3O5S — CID 29379678
[(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate (PubChem CID 29379678) has the molecular formula C24H25N3O5S and a molecular weight of 467.55 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate.
| Compound Name | [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate |
|---|---|
| PubChem CID | 29379678 |
| Molecular Formula | C24H25N3O5S |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.15 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] (E)-3-quinolin-2-ylprop-2-enoate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)[C@@H](C)OC(=O)/C=C/c2ccc3ccccc3n2)cc1 |
| InChI | InChI=1S/C24H25N3O5S/c1-16(2)27-33(30,31)21-13-10-20(11-14-21)26-24(29)17(3)32-23(28)15-12-19-9-8-18-6-4-5-7-22(18)25-19/h4-17,27H,1-3H3,(H,26,29)/b15-12+/t17-/m1/s1 |
| InChIKey | XDLIQHCWLBMINE-OKACTXMXSA-N |
| XLogP | 3.51 |
| TPSA | 114.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|