C17H24N2O5S — CID 42901186
[1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-methylbut-2-enoate (PubChem CID 42901186) has the molecular formula C17H24N2O5S and a molecular weight of 368.46 g/mol. Its IUPAC name is [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-methylbut-2-enoate.
| Compound Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-methylbut-2-enoate |
|---|---|
| PubChem CID | 42901186 |
| Molecular Formula | C17H24N2O5S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.14 |
| IUPAC Name | [1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] 3-methylbut-2-enoate |
| SMILES | CC(C)=CC(=O)OC(C)C(=O)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C17H24N2O5S/c1-11(2)10-16(20)24-13(5)17(21)18-14-6-8-15(9-7-14)25(22,23)19-12(3)4/h6-10,12-13,19H,1-5H3,(H,18,21) |
| InChIKey | WCMPQQHAENGHID-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|