C16H22N2O5S — CID 7863711
[(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] cyclopropanecarboxylate (PubChem CID 7863711) has the molecular formula C16H22N2O5S and a molecular weight of 354.43 g/mol. Its IUPAC name is [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] cyclopropanecarboxylate.
| Compound Name | [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] cyclopropanecarboxylate |
|---|---|
| PubChem CID | 7863711 |
| Molecular Formula | C16H22N2O5S |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | [(2R)-1-oxo-1-[4-(propan-2-ylsulfamoyl)anilino]propan-2-yl] cyclopropanecarboxylate |
| SMILES | CC(C)NS(=O)(=O)c1ccc(NC(=O)[C@@H](C)OC(=O)C2CC2)cc1 |
| InChI | InChI=1S/C16H22N2O5S/c1-10(2)18-24(21,22)14-8-6-13(7-9-14)17-15(19)11(3)23-16(20)12-4-5-12/h6-12,18H,4-5H2,1-3H3,(H,17,19)/t11-/m1/s1 |
| InChIKey | JUGVZUSOTHAILO-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |