C20H30N2O5S — CID 16543429
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-butylcyclohexane-1-carboxylate (PubChem CID 16543429) has the molecular formula C20H30N2O5S and a molecular weight of 410.54 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-butylcyclohexane-1-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 16543429 |
| Molecular Formula | C20H30N2O5S |
| Molecular Weight | 410.54 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 4-butylcyclohexane-1-carboxylate |
| SMILES | CCCCC1CCC(C(=O)OC(C)C(=O)Nc2ccc(S(N)(=O)=O)cc2)CC1 |
| InChI | InChI=1S/C20H30N2O5S/c1-3-4-5-15-6-8-16(9-7-15)20(24)27-14(2)19(23)22-17-10-12-18(13-11-17)28(21,25)26/h10-16H,3-9H2,1-2H3,(H,22,23)(H2,21,25,26) |
| InChIKey | WSUKTZXLOVXKDC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 115.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.54 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |