C20H24N4O7S2 — CID 46602948
[1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602948) has the molecular formula C20H24N4O7S2 and a molecular weight of 496.57 g/mol. Its IUPAC name is [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602948 |
| Molecular Formula | C20H24N4O7S2 |
| Molecular Weight | 496.57 g/mol |
| Exact Mass | 496.11 |
| IUPAC Name | [1-oxo-1-(4-sulfamoylanilino)propan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1)C(=O)Nc1ccc(S(N)(=O)=O)cc1 |
| InChI | InChI=1S/C20H24N4O7S2/c1-14(19(25)23-16-4-6-17(7-5-16)32(21,27)28)31-20(26)15-8-11-24(12-9-15)33(29,30)18-3-2-10-22-13-18/h2-7,10,13-15H,8-9,11-12H2,1H3,(H,23,25)(H2,21,27,28) |
| InChIKey | ZXMCZYGROHRAMG-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 165.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.57 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |