C20H29N3O5S — CID 46602992
[1-(cyclohexylamino)-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602992) has the molecular formula C20H29N3O5S and a molecular weight of 423.54 g/mol. Its IUPAC name is [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602992 |
| Molecular Formula | C20H29N3O5S |
| Molecular Weight | 423.54 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | [1-(cyclohexylamino)-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1)C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C20H29N3O5S/c1-15(19(24)22-17-6-3-2-4-7-17)28-20(25)16-9-12-23(13-10-16)29(26,27)18-8-5-11-21-14-18/h5,8,11,14-17H,2-4,6-7,9-10,12-13H2,1H3,(H,22,24) |
| InChIKey | ZYXVYDSJYROFSO-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 105.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.54 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |