C19H21ClN4O5S — CID 46602577
[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate (PubChem CID 46602577) has the molecular formula C19H21ClN4O5S and a molecular weight of 452.92 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate.
| Compound Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46602577 |
| Molecular Formula | C19H21ClN4O5S |
| Molecular Weight | 452.92 g/mol |
| Exact Mass | 452.09 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-pyridin-3-ylsulfonylpiperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(S(=O)(=O)c2cccnc2)CC1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C19H21ClN4O5S/c1-13(18(25)23-16-5-3-9-22-17(16)20)29-19(26)14-6-10-24(11-7-14)30(27,28)15-4-2-8-21-12-15/h2-5,8-9,12-14H,6-7,10-11H2,1H3,(H,23,25) |
| InChIKey | IMBDIVAQVVPMEP-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 118.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.92 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|