C20H20ClN5O3 — CID 18288407
[1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-(5-cyano-2-pyridinyl)piperidine-4-carboxylate (PubChem CID 18288407) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-(5-cyano-2-pyridinyl)piperidine-4-carboxylate.
| Compound Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-(5-cyano-2-pyridinyl)piperidine-4-carboxylate |
|---|---|
| PubChem CID | 18288407 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | [1-[(2-chloro-3-pyridinyl)amino]-1-oxopropan-2-yl] 1-(5-cyano-2-pyridinyl)piperidine-4-carboxylate |
| SMILES | CC(OC(=O)C1CCN(c2ccc(C#N)cn2)CC1)C(=O)Nc1cccnc1Cl |
| InChI | InChI=1S/C20H20ClN5O3/c1-13(19(27)25-16-3-2-8-23-18(16)21)29-20(28)15-6-9-26(10-7-15)17-5-4-14(11-22)12-24-17/h2-5,8,12-13,15H,6-7,9-10H2,1H3,(H,25,27) |
| InChIKey | YYFNZNNXJFFCOM-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 108.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|