C24H30N2O6S — CID 46624519
[1-(4-ethoxyanilino)-1-oxopropan-2-yl] 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate (PubChem CID 46624519) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate.
| Compound Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
|---|---|
| PubChem CID | 46624519 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | [1-(4-ethoxyanilino)-1-oxopropan-2-yl] 1-(4-methylphenyl)sulfonylpiperidine-4-carboxylate |
| SMILES | CCOc1ccc(NC(=O)C(C)OC(=O)C2CCN(S(=O)(=O)c3ccc(C)cc3)CC2)cc1 |
| InChI | InChI=1S/C24H30N2O6S/c1-4-31-21-9-7-20(8-10-21)25-23(27)18(3)32-24(28)19-13-15-26(16-14-19)33(29,30)22-11-5-17(2)6-12-22/h5-12,18-19H,4,13-16H2,1-3H3,(H,25,27) |
| InChIKey | PGCANHHWGRIGRR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |