C23H31NO4 — CID 7555677
[(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (2R)-2-phenoxybutanoate (PubChem CID 7555677) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (2R)-2-phenoxybutanoate.
| Compound Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (2R)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7555677 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | [(2S)-1-(1-adamantylamino)-1-oxopropan-2-yl] (2R)-2-phenoxybutanoate |
| SMILES | CC[C@@H](Oc1ccccc1)C(=O)O[C@@H](C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C23H31NO4/c1-3-20(28-19-7-5-4-6-8-19)22(26)27-15(2)21(25)24-23-12-16-9-17(13-23)11-18(10-16)14-23/h4-8,15-18,20H,3,9-14H2,1-2H3,(H,24,25)/t15-,16?,17?,18?,20+,23?/m0/s1 |
| InChIKey | REDIBBKEAWPPRX-WOBADCFVSA-N |
| XLogP | 3.86 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |