C23H28N2O5 — CID 7149760
[(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-phenoxybutanoate (PubChem CID 7149760) has the molecular formula C23H28N2O5 and a molecular weight of 412.49 g/mol. Its IUPAC name is [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-phenoxybutanoate.
| Compound Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-phenoxybutanoate |
|---|---|
| PubChem CID | 7149760 |
| Molecular Formula | C23H28N2O5 |
| Molecular Weight | 412.49 g/mol |
| Exact Mass | 412.20 |
| IUPAC Name | [(2S)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-phenoxybutanoate |
| SMILES | CC[C@H](Oc1ccccc1)C(=O)O[C@@H](C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H28N2O5/c1-3-21(30-20-7-5-4-6-8-20)23(27)29-17(2)22(26)24-18-9-11-19(12-10-18)25-13-15-28-16-14-25/h4-12,17,21H,3,13-16H2,1-2H3,(H,24,26)/t17-,21-/m0/s1 |
| InChIKey | ZRSLZYAERMNCMB-UWJYYQICSA-N |
| XLogP | 3.25 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.49 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|