C22H25ClN2O5 — CID 41408806
[(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-(4-chlorophenoxy)propanoate (PubChem CID 41408806) has the molecular formula C22H25ClN2O5 and a molecular weight of 432.90 g/mol. Its IUPAC name is [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-(4-chlorophenoxy)propanoate.
| Compound Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-(4-chlorophenoxy)propanoate |
|---|---|
| PubChem CID | 41408806 |
| Molecular Formula | C22H25ClN2O5 |
| Molecular Weight | 432.90 g/mol |
| Exact Mass | 432.15 |
| IUPAC Name | [(2R)-1-(4-morpholin-4-ylanilino)-1-oxopropan-2-yl] (2S)-2-(4-chlorophenoxy)propanoate |
| SMILES | C[C@H](Oc1ccc(Cl)cc1)C(=O)O[C@H](C)C(=O)Nc1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C22H25ClN2O5/c1-15(30-22(27)16(2)29-20-9-3-17(23)4-10-20)21(26)24-18-5-7-19(8-6-18)25-11-13-28-14-12-25/h3-10,15-16H,11-14H2,1-2H3,(H,24,26)/t15-,16+/m1/s1 |
| InChIKey | RJNWWWQAQDQHDD-CVEARBPZSA-N |
| XLogP | 3.51 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.90 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|