C18H25N3O3S — CID 8535621
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate (PubChem CID 8535621) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate |
|---|---|
| PubChem CID | 8535621 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-ethylthiadiazole-5-carboxylate |
| SMILES | CCc1nnsc1C(=O)O[C@H](C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C18H25N3O3S/c1-3-14-15(25-21-20-14)17(23)24-10(2)16(22)19-18-7-11-4-12(8-18)6-13(5-11)9-18/h10-13H,3-9H2,1-2H3,(H,19,22)/t10-,11?,12?,13?,18?/m1/s1 |
| InChIKey | QKVFVYFDVUEZAN-VALILCMLSA-N |
| XLogP | 2.73 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |