C19H31NO3 — CID 7950815
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3,3-dimethylbutanoate (PubChem CID 7950815) has the molecular formula C19H31NO3 and a molecular weight of 321.46 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3,3-dimethylbutanoate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3,3-dimethylbutanoate |
|---|---|
| PubChem CID | 7950815 |
| Molecular Formula | C19H31NO3 |
| Molecular Weight | 321.46 g/mol |
| Exact Mass | 321.23 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 3,3-dimethylbutanoate |
| SMILES | C[C@@H](OC(=O)CC(C)(C)C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C19H31NO3/c1-12(23-16(21)11-18(2,3)4)17(22)20-19-8-13-5-14(9-19)7-15(6-13)10-19/h12-15H,5-11H2,1-4H3,(H,20,22)/t12-,13?,14?,15?,19?/m1/s1 |
| InChIKey | DYQMIMYTXWSSLH-XUXNNNHQSA-N |
| XLogP | 3.44 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.46 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |