C22H36N2O5 — CID 8947692
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate (PubChem CID 8947692) has the molecular formula C22H36N2O5 and a molecular weight of 408.54 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
|---|---|
| PubChem CID | 8947692 |
| Molecular Formula | C22H36N2O5 |
| Molecular Weight | 408.54 g/mol |
| Exact Mass | 408.26 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 4-[(2-methylpropan-2-yl)oxycarbonylamino]butanoate |
| SMILES | C[C@@H](OC(=O)CCCNC(=O)OC(C)(C)C)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C22H36N2O5/c1-14(28-18(25)6-5-7-23-20(27)29-21(2,3)4)19(26)24-22-11-15-8-16(12-22)10-17(9-15)13-22/h14-17H,5-13H2,1-4H3,(H,23,27)(H,24,26)/t14-,15?,16?,17?,22?/m1/s1 |
| InChIKey | BNNGZAVAUFPYPQ-XSXQVXRUSA-N |
| XLogP | 3.31 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.54 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|