C23H31NO4 — CID 8923092
[(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 8923092) has the molecular formula C23H31NO4 and a molecular weight of 385.50 g/mol. Its IUPAC name is [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8923092 |
| Molecular Formula | C23H31NO4 |
| Molecular Weight | 385.50 g/mol |
| Exact Mass | 385.23 |
| IUPAC Name | [(2R)-1-(1-adamantylamino)-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)O[C@H](C)C(=O)NC23CC4CC(CC(C4)C2)C3)cc1C |
| InChI | InChI=1S/C23H31NO4/c1-14-4-5-20(6-15(14)2)27-13-21(25)28-16(3)22(26)24-23-10-17-7-18(11-23)9-19(8-17)12-23/h4-6,16-19H,7-13H2,1-3H3,(H,24,26)/t16-,17?,18?,19?,23?/m1/s1 |
| InChIKey | FSFOOUUYZJNYTN-DNBYOKIBSA-N |
| XLogP | 3.70 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.50 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |