C21H29NO4 — CID 8923017
[(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate (PubChem CID 8923017) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate.
| Compound Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate |
|---|---|
| PubChem CID | 8923017 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | [(2S)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(3,4-dimethylphenoxy)acetate |
| SMILES | Cc1ccc(OCC(=O)O[C@@H](C)C(=O)NCCC2=CCCCC2)cc1C |
| InChI | InChI=1S/C21H29NO4/c1-15-9-10-19(13-16(15)2)25-14-20(23)26-17(3)21(24)22-12-11-18-7-5-4-6-8-18/h7,9-10,13,17H,4-6,8,11-12,14H2,1-3H3,(H,22,24)/t17-/m0/s1 |
| InChIKey | BPWHNOWEHDSYHO-KRWDZBQOSA-N |
| XLogP | 3.62 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|