C23H29NO4 — CID 7251864
[(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate (PubChem CID 7251864) has the molecular formula C23H29NO4 and a molecular weight of 383.49 g/mol. Its IUPAC name is [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate.
| Compound Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
|---|---|
| PubChem CID | 7251864 |
| Molecular Formula | C23H29NO4 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.21 |
| IUPAC Name | [(2R)-1-[2-(cyclohexen-1-yl)ethylamino]-1-oxopropan-2-yl] 2-(5,6-dimethyl-1-benzofuran-3-yl)acetate |
| SMILES | Cc1cc2occ(CC(=O)O[C@H](C)C(=O)NCCC3=CCCCC3)c2cc1C |
| InChI | InChI=1S/C23H29NO4/c1-15-11-20-19(14-27-21(20)12-16(15)2)13-22(25)28-17(3)23(26)24-10-9-18-7-5-4-6-8-18/h7,11-12,14,17H,4-6,8-10,13H2,1-3H3,(H,24,26)/t17-/m1/s1 |
| InChIKey | XFBPFVKXJTYFTF-QGZVFWFLSA-N |
| XLogP | 4.53 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|