C21H28N2O5 — CID 154763430
[1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate (PubChem CID 154763430) has the molecular formula C21H28N2O5 and a molecular weight of 388.46 g/mol. Its IUPAC name is [1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate.
| Compound Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate |
|---|---|
| PubChem CID | 154763430 |
| Molecular Formula | C21H28N2O5 |
| Molecular Weight | 388.46 g/mol |
| Exact Mass | 388.20 |
| IUPAC Name | [1-(1-adamantylamino)-1-oxopropan-2-yl] 3-(furan-2-carbonylamino)propanoate |
| SMILES | CC(OC(=O)CCNC(=O)c1ccco1)C(=O)NC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H28N2O5/c1-13(28-18(24)4-5-22-20(26)17-3-2-6-27-17)19(25)23-21-10-14-7-15(11-21)9-16(8-14)12-21/h2-3,6,13-16H,4-5,7-12H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | CJXQVYBOCREFBH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.46 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |