C9H14N2O4 — CID 29201327
[(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] cyclobutanecarboxylate (PubChem CID 29201327) has the molecular formula C9H14N2O4 and a molecular weight of 214.22 g/mol. Its IUPAC name is [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] cyclobutanecarboxylate.
| Compound Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
|---|---|
| PubChem CID | 29201327 |
| Molecular Formula | C9H14N2O4 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | [(2R)-1-(carbamoylamino)-1-oxopropan-2-yl] cyclobutanecarboxylate |
| SMILES | C[C@@H](OC(=O)C1CCC1)C(=O)NC(N)=O |
| InChI | InChI=1S/C9H14N2O4/c1-5(7(12)11-9(10)14)15-8(13)6-3-2-4-6/h5-6H,2-4H2,1H3,(H3,10,11,12,14)/t5-/m1/s1 |
| InChIKey | IWEHLUGNFVYSGX-RXMQYKEDSA-N |
| XLogP | -0.09 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |