C16H28N2O4 — CID 40620132
[(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 40620132) has the molecular formula C16H28N2O4 and a molecular weight of 312.41 g/mol. Its IUPAC name is [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 40620132 |
| Molecular Formula | C16H28N2O4 |
| Molecular Weight | 312.41 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | [(2R)-1-(methylcarbamoylamino)-1-oxopropan-2-yl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CNC(=O)NC(=O)[C@@H](C)OC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C16H28N2O4/c1-10(13(19)18-15(21)17-5)22-14(20)11-6-8-12(9-7-11)16(2,3)4/h10-12H,6-9H2,1-5H3,(H2,17,18,19,21)/t10-,11?,12?/m1/s1 |
| InChIKey | MZCIAZMHJVXVTJ-VOMCLLRMSA-N |
| XLogP | 2.23 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.41 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |