C18H32N2O4 — CID 42971186
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 42971186) has the molecular formula C18H32N2O4 and a molecular weight of 340.46 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 42971186 |
| Molecular Formula | C18H32N2O4 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C18H32N2O4/c1-12(2)10-19-17(23)20-15(21)11-24-16(22)13-6-8-14(9-7-13)18(3,4)5/h12-14H,6-11H2,1-5H3,(H2,19,20,21,23) |
| InChIKey | LTEFLCJBAKKEGO-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |