C23H35NO3 — CID 2369687
[2-oxo-2-[[(2S)-4-phenylbutan-2-yl]amino]ethyl] 4-tert-butylcyclohexane-1-carboxylate (PubChem CID 2369687) has the molecular formula C23H35NO3 and a molecular weight of 373.54 g/mol. Its IUPAC name is [2-oxo-2-[[(2S)-4-phenylbutan-2-yl]amino]ethyl] 4-tert-butylcyclohexane-1-carboxylate.
| Compound Name | [2-oxo-2-[[(2S)-4-phenylbutan-2-yl]amino]ethyl] 4-tert-butylcyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 2369687 |
| Molecular Formula | C23H35NO3 |
| Molecular Weight | 373.54 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | [2-oxo-2-[[(2S)-4-phenylbutan-2-yl]amino]ethyl] 4-tert-butylcyclohexane-1-carboxylate |
| SMILES | C[C@@H](CCc1ccccc1)NC(=O)COC(=O)C1CCC(C(C)(C)C)CC1 |
| InChI | InChI=1S/C23H35NO3/c1-17(10-11-18-8-6-5-7-9-18)24-21(25)16-27-22(26)19-12-14-20(15-13-19)23(2,3)4/h5-9,17,19-20H,10-16H2,1-4H3,(H,24,25)/t17-,19?,20?/m0/s1 |
| InChIKey | WVZVXOCYNYNXCY-KKXNLOMOSA-N |
| XLogP | 4.52 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.54 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |