C23H31NO3 — CID 8518380
[2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] adamantane-2-carboxylate (PubChem CID 8518380) has the molecular formula C23H31NO3 and a molecular weight of 369.51 g/mol. Its IUPAC name is [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] adamantane-2-carboxylate.
| Compound Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8518380 |
| Molecular Formula | C23H31NO3 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.23 |
| IUPAC Name | [2-oxo-2-[[(2R)-4-phenylbutan-2-yl]amino]ethyl] adamantane-2-carboxylate |
| SMILES | C[C@H](CCc1ccccc1)NC(=O)COC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H31NO3/c1-15(7-8-16-5-3-2-4-6-16)24-21(25)14-27-23(26)22-19-10-17-9-18(12-19)13-20(22)11-17/h2-6,15,17-20,22H,7-14H2,1H3,(H,24,25)/t15-,17?,18?,19?,20?,22?/m1/s1 |
| InChIKey | XWFUDDKKJFZZHI-YLDONLODSA-N |
| XLogP | 3.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |