C18H28N2O4 — CID 8519506
[2-(2-methylpropylcarbamoylamino)-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8519506) has the molecular formula C18H28N2O4 and a molecular weight of 336.43 g/mol. Its IUPAC name is [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519506 |
| Molecular Formula | C18H28N2O4 |
| Molecular Weight | 336.43 g/mol |
| Exact Mass | 336.20 |
| IUPAC Name | [2-(2-methylpropylcarbamoylamino)-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | CC(C)CNC(=O)NC(=O)COC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C18H28N2O4/c1-10(2)8-19-18(23)20-15(21)9-24-17(22)16-13-4-11-3-12(6-13)7-14(16)5-11/h10-14,16H,3-9H2,1-2H3,(H2,19,20,21,23) |
| InChIKey | FFOQEVJPINRHJV-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.43 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |