C22H32N2O4 — CID 8519879
[2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8519879) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519879 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [2-[2-(cyclohexen-1-yl)ethylcarbamoylamino]-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | O=C(COC(=O)C1C2CC3CC(C2)CC1C3)NC(=O)NCCC1=CCCCC1 |
| InChI | InChI=1S/C22H32N2O4/c25-19(24-22(27)23-7-6-14-4-2-1-3-5-14)13-28-21(26)20-17-9-15-8-16(11-17)12-18(20)10-15/h4,15-18,20H,1-3,5-13H2,(H2,23,24,25,27) |
| InChIKey | FFKBRHLRRMFLIA-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|