C20H31NO3 — CID 8519367
[2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8519367) has the molecular formula C20H31NO3 and a molecular weight of 333.47 g/mol. Its IUPAC name is [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8519367 |
| Molecular Formula | C20H31NO3 |
| Molecular Weight | 333.47 g/mol |
| Exact Mass | 333.23 |
| IUPAC Name | [2-[[(1R,2S)-2-methylcyclohexyl]amino]-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | C[C@H]1CCCC[C@H]1NC(=O)COC(=O)C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C20H31NO3/c1-12-4-2-3-5-17(12)21-18(22)11-24-20(23)19-15-7-13-6-14(9-15)10-16(19)8-13/h12-17,19H,2-11H2,1H3,(H,21,22)/t12-,13?,14?,15?,16?,17+,19?/m0/s1 |
| InChIKey | DEMYLHCDRGWBQK-LBZRDPAVSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.47 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |