C18H27NO3 — CID 8518445
[2-(cyclopentylamino)-2-oxoethyl] adamantane-2-carboxylate (PubChem CID 8518445) has the molecular formula C18H27NO3 and a molecular weight of 305.42 g/mol. Its IUPAC name is [2-(cyclopentylamino)-2-oxoethyl] adamantane-2-carboxylate.
| Compound Name | [2-(cyclopentylamino)-2-oxoethyl] adamantane-2-carboxylate |
|---|---|
| PubChem CID | 8518445 |
| Molecular Formula | C18H27NO3 |
| Molecular Weight | 305.42 g/mol |
| Exact Mass | 305.20 |
| IUPAC Name | [2-(cyclopentylamino)-2-oxoethyl] adamantane-2-carboxylate |
| SMILES | O=C(COC(=O)C1C2CC3CC(C2)CC1C3)NC1CCCC1 |
| InChI | InChI=1S/C18H27NO3/c20-16(19-15-3-1-2-4-15)10-22-18(21)17-13-6-11-5-12(8-13)9-14(17)7-11/h11-15,17H,1-10H2,(H,19,20) |
| InChIKey | FGMIHPVHPFGNOW-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.42 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |