C12H19NO2 — CID 170045974
2-buta-1,3-dien-2-yloxy-N-cyclohexylacetamide (PubChem CID 170045974) has the molecular formula C12H19NO2 and a molecular weight of 209.29 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yloxy-N-cyclohexylacetamide.
| Compound Name | 2-buta-1,3-dien-2-yloxy-N-cyclohexylacetamide |
|---|---|
| PubChem CID | 170045974 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | 2-buta-1,3-dien-2-yloxy-N-cyclohexylacetamide |
| SMILES | C=CC(=C)OCC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C12H19NO2/c1-3-10(2)15-9-12(14)13-11-7-5-4-6-8-11/h3,11H,1-2,4-9H2,(H,13,14) |
| InChIKey | IMUFQMJZWQOTPQ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|