C12H16ClNO2 — CID 170045793
2-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]oxy-N-cyclobutylacetamide (PubChem CID 170045793) has the molecular formula C12H16ClNO2 and a molecular weight of 241.72 g/mol. Its IUPAC name is 2-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]oxy-N-cyclobutylacetamide.
| Compound Name | 2-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]oxy-N-cyclobutylacetamide |
|---|---|
| PubChem CID | 170045793 |
| Molecular Formula | C12H16ClNO2 |
| Molecular Weight | 241.72 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 2-[(3E,5E)-6-chlorohexa-1,3,5-trien-3-yl]oxy-N-cyclobutylacetamide |
| SMILES | C=C/C(=C\C=C\Cl)OCC(=O)NC1CCC1 |
| InChI | InChI=1S/C12H16ClNO2/c1-2-11(7-4-8-13)16-9-12(15)14-10-5-3-6-10/h2,4,7-8,10H,1,3,5-6,9H2,(H,14,15)/b8-4+,11-7+ |
| InChIKey | RCYYGZDXHMUPJN-RIALUSDFSA-N |
| XLogP | 2.49 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.72 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|