C13H19NO2 — CID 154687231
[(3E)-hexa-1,3,5-trien-3-yl] N-cyclohexylcarbamate (PubChem CID 154687231) has the molecular formula C13H19NO2 and a molecular weight of 221.30 g/mol. Its IUPAC name is [(3E)-hexa-1,3,5-trien-3-yl] N-cyclohexylcarbamate.
| Compound Name | [(3E)-hexa-1,3,5-trien-3-yl] N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 154687231 |
| Molecular Formula | C13H19NO2 |
| Molecular Weight | 221.30 g/mol |
| Exact Mass | 221.14 |
| IUPAC Name | [(3E)-hexa-1,3,5-trien-3-yl] N-cyclohexylcarbamate |
| SMILES | C=C/C=C(\C=C)OC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H19NO2/c1-3-8-12(4-2)16-13(15)14-11-9-6-5-7-10-11/h3-4,8,11H,1-2,5-7,9-10H2,(H,14,15)/b12-8+ |
| InChIKey | SLOZGYFRUVCIRT-XYOKQWHBSA-N |
| XLogP | 3.30 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|