C15H24N2O2 — CID 174429231
N-cyclohexylprop-2-enamide;N-prop-2-enylprop-2-enamide (PubChem CID 174429231) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is N-cyclohexylprop-2-enamide;N-prop-2-enylprop-2-enamide.
| Compound Name | N-cyclohexylprop-2-enamide;N-prop-2-enylprop-2-enamide |
|---|---|
| PubChem CID | 174429231 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | N-cyclohexylprop-2-enamide;N-prop-2-enylprop-2-enamide |
| SMILES | C=CC(=O)NC1CCCCC1.C=CCNC(=O)C=C |
| InChI | InChI=1S/C9H15NO.C6H9NO/c1-2-9(11)10-8-6-4-3-5-7-8;1-3-5-7-6(8)4-2/h2,8H,1,3-7H2,(H,10,11);3-4H,1-2,5H2,(H,7,8) |
| InChIKey | HBJDUIAVEHAIGW-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|