C32H52N4O4 — CID 139188308
(Z)-N,N'-dicyclohexylbut-2-enediamide (PubChem CID 139188308) has the molecular formula C32H52N4O4 and a molecular weight of 556.79 g/mol. Its IUPAC name is (Z)-N,N'-dicyclohexylbut-2-enediamide.
| Compound Name | (Z)-N,N'-dicyclohexylbut-2-enediamide |
|---|---|
| PubChem CID | 139188308 |
| Molecular Formula | C32H52N4O4 |
| Molecular Weight | 556.79 g/mol |
| Exact Mass | 556.40 |
| IUPAC Name | (Z)-N,N'-dicyclohexylbut-2-enediamide |
| SMILES | O=C(/C=C\C(=O)NC1CCCCC1)NC1CCCCC1.O=C(/C=C\C(=O)NC1CCCCC1)NC1CCCCC1 |
| InChI | InChI=1S/2C16H26N2O2/c2*19-15(17-13-7-3-1-4-8-13)11-12-16(20)18-14-9-5-2-6-10-14/h2*11-14H,1-10H2,(H,17,19)(H,18,20)/b2*12-11- |
| InChIKey | IOWFRDWIHYMBKQ-ZVMXUFIRSA-N |
| XLogP | 4.88 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.79 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|