C14H25NO — CID 166823863
(E)-N-cyclohexyl-4,4-dimethylhex-2-enamide (PubChem CID 166823863) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (E)-N-cyclohexyl-4,4-dimethylhex-2-enamide.
| Compound Name | (E)-N-cyclohexyl-4,4-dimethylhex-2-enamide |
|---|---|
| PubChem CID | 166823863 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (E)-N-cyclohexyl-4,4-dimethylhex-2-enamide |
| SMILES | CCC(C)(C)/C=C/C(=O)NC1CCCCC1 |
| InChI | InChI=1S/C14H25NO/c1-4-14(2,3)11-10-13(16)15-12-8-6-5-7-9-12/h10-12H,4-9H2,1-3H3,(H,15,16)/b11-10+ |
| InChIKey | AQPOZQXWVVXPRN-ZHACJKMWSA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|