About N-cyclohexylcarbamoyl chloride
N-cyclohexylcarbamoyl chloride (PubChem CID 22252134) has the molecular formula C7H12ClNO
and a molecular weight of 161.63 g/mol. Its IUPAC name is N-cyclohexylcarbamoyl chloride.
Molecular Properties
| Compound Name | N-cyclohexylcarbamoyl chloride |
| PubChem CID | 22252134 |
| Molecular Formula | C7H12ClNO |
| Molecular Weight | 161.63 g/mol |
| Exact Mass | 161.06 |
| IUPAC Name | N-cyclohexylcarbamoyl chloride |
| SMILES | O=C(Cl)NC1CCCCC1 |
| InChI | InChI=1S/C7H12ClNO/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H,9,10) |
| InChIKey | FOZLEFALTUHOLA-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.63 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|
Analyze N-cyclohexylcarbamoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexylcarbamoyl chloride?
The IUPAC name of N-cyclohexylcarbamoyl chloride (CID 22252134) is N-cyclohexylcarbamoyl chloride.
What is the SMILES notation for N-cyclohexylcarbamoyl chloride?
The canonical SMILES for N-cyclohexylcarbamoyl chloride is O=C(Cl)NC1CCCCC1.
What is the InChIKey of N-cyclohexylcarbamoyl chloride?
The InChIKey is FOZLEFALTUHOLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12ClNO/c8-7(10)9-6-4-2-1-3-5-6/h6H,1-5H2,(H,9,10).
What are the key properties of N-cyclohexylcarbamoyl chloride?
N-cyclohexylcarbamoyl chloride has a molecular weight of 161.63 g/mol, XLogP of 2.27, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexylcarbamoyl chloride is sourced from PubChem (CID 22252134), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).