C14H26N4O — CID 110981261
N-cyclohexyl-2-[[ethylamino-(prop-2-enylamino)methylidene]amino]acetamide (PubChem CID 110981261) has the molecular formula C14H26N4O and a molecular weight of 266.39 g/mol. Its IUPAC name is N-cyclohexyl-2-[[ethylamino-(prop-2-enylamino)methylidene]amino]acetamide.
| Compound Name | N-cyclohexyl-2-[[ethylamino-(prop-2-enylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110981261 |
| Molecular Formula | C14H26N4O |
| Molecular Weight | 266.39 g/mol |
| Exact Mass | 266.21 |
| IUPAC Name | N-cyclohexyl-2-[[ethylamino-(prop-2-enylamino)methylidene]amino]acetamide |
| SMILES | C=CCN/C(=N/CC(=O)NC1CCCCC1)NCC |
| InChI | InChI=1S/C14H26N4O/c1-3-10-16-14(15-4-2)17-11-13(19)18-12-8-6-5-7-9-12/h3,12H,1,4-11H2,2H3,(H,18,19)(H2,15,16,17) |
| InChIKey | UWZZDFXMBDSMOF-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.39 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|