C15H31IN4O — CID 110965625
2-[[(tert-butylamino)-(ethylamino)methylidene]amino]-N-cyclohexylacetamide;hydroiodide (PubChem CID 110965625) has the molecular formula C15H31IN4O and a molecular weight of 410.34 g/mol. Its IUPAC name is 2-[[(tert-butylamino)-(ethylamino)methylidene]amino]-N-cyclohexylacetamide;hydroiodide.
| Compound Name | 2-[[(tert-butylamino)-(ethylamino)methylidene]amino]-N-cyclohexylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110965625 |
| Molecular Formula | C15H31IN4O |
| Molecular Weight | 410.34 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | 2-[[(tert-butylamino)-(ethylamino)methylidene]amino]-N-cyclohexylacetamide;hydroiodide |
| SMILES | CCN/C(=N\CC(=O)NC1CCCCC1)NC(C)(C)C.I |
| InChI | InChI=1S/C15H30N4O.HI/c1-5-16-14(19-15(2,3)4)17-11-13(20)18-12-9-7-6-8-10-12;/h12H,5-11H2,1-4H3,(H,18,20)(H2,16,17,19);1H |
| InChIKey | XSKYTRXATGRRNV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 65.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.34 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|