C13H21NO3 — CID 89330994
2-buta-1,3-dien-2-yloxyethyl N-cyclohexylcarbamate (PubChem CID 89330994) has the molecular formula C13H21NO3 and a molecular weight of 239.31 g/mol. Its IUPAC name is 2-buta-1,3-dien-2-yloxyethyl N-cyclohexylcarbamate.
| Compound Name | 2-buta-1,3-dien-2-yloxyethyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 89330994 |
| Molecular Formula | C13H21NO3 |
| Molecular Weight | 239.31 g/mol |
| Exact Mass | 239.15 |
| IUPAC Name | 2-buta-1,3-dien-2-yloxyethyl N-cyclohexylcarbamate |
| SMILES | C=CC(=C)OCCOC(=O)NC1CCCCC1 |
| InChI | InChI=1S/C13H21NO3/c1-3-11(2)16-9-10-17-13(15)14-12-7-5-4-6-8-12/h3,12H,1-2,4-10H2,(H,14,15) |
| InChIKey | PAVLMIIJDNMOAQ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.31 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|