2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen

C9H20N2O2 — CID 159671742

IUPAC2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen
SMILESNCCOC(=O)NC1CCCCC1.[H][H]
InChIInChI=1S/C9H18N2O2.H2/c10-6-7-13-9(12)11-8-4-2-1-3-5-8;/h8H,1-7,10H2,(H,11,12);1H
InChIKeyMUBXQYKONIRZIZ-UHFFFAOYSA-N
MW188.27 g/mol
LogP1.25
Rot. Bonds3

About 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen

2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen (PubChem CID 159671742) has the molecular formula C9H20N2O2 and a molecular weight of 188.27 g/mol. Its IUPAC name is 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen.

Molecular Properties

Compound Name2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen
PubChem CID159671742
Molecular FormulaC9H20N2O2
Molecular Weight188.27 g/mol
Exact Mass188.15
IUPAC Name2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen
SMILESNCCOC(=O)NC1CCCCC1.[H][H]
InChIInChI=1S/C9H18N2O2.H2/c10-6-7-13-9(12)11-8-4-2-1-3-5-8;/h8H,1-7,10H2,(H,11,12);1H
InChIKeyMUBXQYKONIRZIZ-UHFFFAOYSA-N
XLogP1.25
TPSA64.35 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.27
LogP ≤ 51.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Analyze 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen?
The IUPAC name of 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen (CID 159671742) is 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen.
What is the SMILES notation for 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen?
The canonical SMILES for 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen is NCCOC(=O)NC1CCCCC1.[H][H].
What is the InChIKey of 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen?
The InChIKey is MUBXQYKONIRZIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18N2O2.H2/c10-6-7-13-9(12)11-8-4-2-1-3-5-8;/h8H,1-7,10H2,(H,11,12);1H.
What are the key properties of 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen?
2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen has a molecular weight of 188.27 g/mol, XLogP of 1.25, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoethyl N-cyclohexylcarbamate;molecular hydrogen is sourced from PubChem (CID 159671742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).