About [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate
[(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate (PubChem CID 97048112) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate |
| PubChem CID | 97048112 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OC[C@H]1CCCN1 |
| InChI | InChI=1S/C12H22N2O2/c15-12(14-10-5-2-1-3-6-10)16-9-11-7-4-8-13-11/h10-11,13H,1-9H2,(H,14,15)/t11-/m1/s1 |
| InChIKey | MJTQAKWQSBCIFP-LLVKDONJSA-N |
| XLogP | 1.80 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate?
The IUPAC name of [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate (CID 97048112) is [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate.
What is the SMILES notation for [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate?
The canonical SMILES for [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate is O=C(NC1CCCCC1)OC[C@H]1CCCN1.
What is the InChIKey of [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate?
The InChIKey is MJTQAKWQSBCIFP-LLVKDONJSA-N. The full InChI is InChI=1S/C12H22N2O2/c15-12(14-10-5-2-1-3-6-10)16-9-11-7-4-8-13-11/h10-11,13H,1-9H2,(H,14,15)/t11-/m1/s1.
What are the key properties of [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate?
[(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate has a molecular weight of 226.32 g/mol, XLogP of 1.80, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-pyrrolidin-2-yl]methyl N-cyclohexylcarbamate is sourced from PubChem (CID 97048112), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).