C12H22N2O4S2 — CID 75632443
(1,1-dioxo-1,5,2-dithiazepan-3-yl)methyl N-cyclohexylcarbamate (PubChem CID 75632443) has the molecular formula C12H22N2O4S2 and a molecular weight of 322.45 g/mol. Its IUPAC name is (1,1-dioxo-1,5,2-dithiazepan-3-yl)methyl N-cyclohexylcarbamate.
| Compound Name | (1,1-dioxo-1,5,2-dithiazepan-3-yl)methyl N-cyclohexylcarbamate |
|---|---|
| PubChem CID | 75632443 |
| Molecular Formula | C12H22N2O4S2 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | (1,1-dioxo-1,5,2-dithiazepan-3-yl)methyl N-cyclohexylcarbamate |
| SMILES | O=C(NC1CCCCC1)OCC1CSCCS(=O)(=O)N1 |
| InChI | InChI=1S/C12H22N2O4S2/c15-12(13-10-4-2-1-3-5-10)18-8-11-9-19-6-7-20(16,17)14-11/h10-11,14H,1-9H2,(H,13,15) |
| InChIKey | JIBPORWWYUABPT-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |