C26H34N2O6S2 — CID 161051736
benzyl N-(1,1-dioxothian-4-yl)carbamate;benzyl N-(thian-4-yl)carbamate (PubChem CID 161051736) has the molecular formula C26H34N2O6S2 and a molecular weight of 534.70 g/mol. Its IUPAC name is benzyl N-(1,1-dioxothian-4-yl)carbamate;benzyl N-(thian-4-yl)carbamate.
| Compound Name | benzyl N-(1,1-dioxothian-4-yl)carbamate;benzyl N-(thian-4-yl)carbamate |
|---|---|
| PubChem CID | 161051736 |
| Molecular Formula | C26H34N2O6S2 |
| Molecular Weight | 534.70 g/mol |
| Exact Mass | 534.19 |
| IUPAC Name | benzyl N-(1,1-dioxothian-4-yl)carbamate;benzyl N-(thian-4-yl)carbamate |
| SMILES | O=C(NC1CCS(=O)(=O)CC1)OCc1ccccc1.O=C(NC1CCSCC1)OCc1ccccc1 |
| InChI | InChI=1S/C13H17NO4S.C13H17NO2S/c15-13(18-10-11-4-2-1-3-5-11)14-12-6-8-19(16,17)9-7-12;15-13(14-12-6-8-17-9-7-12)16-10-11-4-2-1-3-5-11/h1-5,12H,6-10H2,(H,14,15);1-5,12H,6-10H2,(H,14,15) |
| InChIKey | UCFOBWVTNIVRGC-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.70 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |