About pyrrolidin-2-ylmethyl azepane-1-carboxylate
pyrrolidin-2-ylmethyl azepane-1-carboxylate (PubChem CID 79337608) has the molecular formula C12H22N2O2
and a molecular weight of 226.32 g/mol. Its IUPAC name is pyrrolidin-2-ylmethyl azepane-1-carboxylate.
Molecular Properties
| Compound Name | pyrrolidin-2-ylmethyl azepane-1-carboxylate |
| PubChem CID | 79337608 |
| Molecular Formula | C12H22N2O2 |
| Molecular Weight | 226.32 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | pyrrolidin-2-ylmethyl azepane-1-carboxylate |
| SMILES | O=C(OCC1CCCN1)N1CCCCCC1 |
| InChI | InChI=1S/C12H22N2O2/c15-12(14-8-3-1-2-4-9-14)16-10-11-6-5-7-13-11/h11,13H,1-10H2 |
| InChIKey | QCVZDXDYMMUZLS-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.32 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze pyrrolidin-2-ylmethyl azepane-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pyrrolidin-2-ylmethyl azepane-1-carboxylate?
The IUPAC name of pyrrolidin-2-ylmethyl azepane-1-carboxylate (CID 79337608) is pyrrolidin-2-ylmethyl azepane-1-carboxylate.
What is the SMILES notation for pyrrolidin-2-ylmethyl azepane-1-carboxylate?
The canonical SMILES for pyrrolidin-2-ylmethyl azepane-1-carboxylate is O=C(OCC1CCCN1)N1CCCCCC1.
What is the InChIKey of pyrrolidin-2-ylmethyl azepane-1-carboxylate?
The InChIKey is QCVZDXDYMMUZLS-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22N2O2/c15-12(14-8-3-1-2-4-9-14)16-10-11-6-5-7-13-11/h11,13H,1-10H2.
What are the key properties of pyrrolidin-2-ylmethyl azepane-1-carboxylate?
pyrrolidin-2-ylmethyl azepane-1-carboxylate has a molecular weight of 226.32 g/mol, XLogP of 1.75, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for pyrrolidin-2-ylmethyl azepane-1-carboxylate is sourced from PubChem (CID 79337608), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).