About 4-(4-methylphenyl)butyl N-cyclohexylcarbamate
4-(4-methylphenyl)butyl N-cyclohexylcarbamate (PubChem CID 90359705) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is 4-(4-methylphenyl)butyl N-cyclohexylcarbamate.
Molecular Properties
| Compound Name | 4-(4-methylphenyl)butyl N-cyclohexylcarbamate |
| PubChem CID | 90359705 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 4-(4-methylphenyl)butyl N-cyclohexylcarbamate |
| SMILES | Cc1ccc(CCCCOC(=O)NC2CCCCC2)cc1 |
| InChI | InChI=1S/C18H27NO2/c1-15-10-12-16(13-11-15)7-5-6-14-21-18(20)19-17-8-3-2-4-9-17/h10-13,17H,2-9,14H2,1H3,(H,19,20) |
| InChIKey | OBSRBNTXFPETDI-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-(4-methylphenyl)butyl N-cyclohexylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(4-methylphenyl)butyl N-cyclohexylcarbamate?
The IUPAC name of 4-(4-methylphenyl)butyl N-cyclohexylcarbamate (CID 90359705) is 4-(4-methylphenyl)butyl N-cyclohexylcarbamate.
What is the SMILES notation for 4-(4-methylphenyl)butyl N-cyclohexylcarbamate?
The canonical SMILES for 4-(4-methylphenyl)butyl N-cyclohexylcarbamate is Cc1ccc(CCCCOC(=O)NC2CCCCC2)cc1.
What is the InChIKey of 4-(4-methylphenyl)butyl N-cyclohexylcarbamate?
The InChIKey is OBSRBNTXFPETDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H27NO2/c1-15-10-12-16(13-11-15)7-5-6-14-21-18(20)19-17-8-3-2-4-9-17/h10-13,17H,2-9,14H2,1H3,(H,19,20).
What are the key properties of 4-(4-methylphenyl)butyl N-cyclohexylcarbamate?
4-(4-methylphenyl)butyl N-cyclohexylcarbamate has a molecular weight of 289.42 g/mol, XLogP of 4.38, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(4-methylphenyl)butyl N-cyclohexylcarbamate is sourced from PubChem (CID 90359705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).