C18H25ClN2O3 — CID 108566503
2-chloroethyl N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]carbamate (PubChem CID 108566503) has the molecular formula C18H25ClN2O3 and a molecular weight of 352.86 g/mol. Its IUPAC name is 2-chloroethyl N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]carbamate.
| Compound Name | 2-chloroethyl N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108566503 |
| Molecular Formula | C18H25ClN2O3 |
| Molecular Weight | 352.86 g/mol |
| Exact Mass | 352.16 |
| IUPAC Name | 2-chloroethyl N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]carbamate |
| SMILES | Cc1ccc(CCC(=O)N2CCC(NC(=O)OCCCl)CC2)cc1 |
| InChI | InChI=1S/C18H25ClN2O3/c1-14-2-4-15(5-3-14)6-7-17(22)21-11-8-16(9-12-21)20-18(23)24-13-10-19/h2-5,16H,6-13H2,1H3,(H,20,23) |
| InChIKey | YIMQHKYZQRILPC-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.86 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|