C24H36N2O2 — CID 108555735
3-cyclohexyl-N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]propanamide (PubChem CID 108555735) has the molecular formula C24H36N2O2 and a molecular weight of 384.56 g/mol. Its IUPAC name is 3-cyclohexyl-N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]propanamide.
| Compound Name | 3-cyclohexyl-N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]propanamide |
|---|---|
| PubChem CID | 108555735 |
| Molecular Formula | C24H36N2O2 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.28 |
| IUPAC Name | 3-cyclohexyl-N-[1-[3-(4-methylphenyl)propanoyl]piperidin-4-yl]propanamide |
| SMILES | Cc1ccc(CCC(=O)N2CCC(NC(=O)CCC3CCCCC3)CC2)cc1 |
| InChI | InChI=1S/C24H36N2O2/c1-19-7-9-21(10-8-19)12-14-24(28)26-17-15-22(16-18-26)25-23(27)13-11-20-5-3-2-4-6-20/h7-10,20,22H,2-6,11-18H2,1H3,(H,25,27) |
| InChIKey | ZIPGENXAVLHWCZ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |